About 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one
5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one (PubChem CID 161118058) has the molecular formula C31H22O6
and a molecular weight of 490.51 g/mol. Its IUPAC name is 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one |
| PubChem CID | 161118058 |
| Molecular Formula | C31H22O6 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1.O=c1cc(-c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C16H12O4.C15H10O2/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10;16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h2-9,17H,1H3;1-10H |
| InChIKey | UKOSFZHSKGHEID-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one?
The IUPAC name of 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one (CID 161118058) is 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one.
What is the SMILES notation for 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one?
The canonical SMILES for 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one is COc1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1.O=c1cc(-c2ccccc2)oc2ccccc12.
What is the InChIKey of 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one?
The InChIKey is UKOSFZHSKGHEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O4.C15H10O2/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10;16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h2-9,17H,1H3;1-10H.
What are the key properties of 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one?
5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one has a molecular weight of 490.51 g/mol, XLogP of 6.63, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-7-methoxy-2-phenylchromen-4-one;2-phenylchromen-4-one is sourced from PubChem (CID 161118058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).