C34H28O10 — CID 139068259
5-hydroxy-3,7-dimethoxy-2-phenylchromen-4-one (PubChem CID 139068259) has the molecular formula C34H28O10 and a molecular weight of 596.59 g/mol. Its IUPAC name is 5-hydroxy-3,7-dimethoxy-2-phenylchromen-4-one.
| Compound Name | 5-hydroxy-3,7-dimethoxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 139068259 |
| Molecular Formula | C34H28O10 |
| Molecular Weight | 596.59 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 5-hydroxy-3,7-dimethoxy-2-phenylchromen-4-one |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3ccccc3)oc2c1.COc1cc(O)c2c(=O)c(OC)c(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/2C17H14O5/c2*1-20-11-8-12(18)14-13(9-11)22-16(17(21-2)15(14)19)10-6-4-3-5-7-10/h2*3-9,18H,1-2H3 |
| InChIKey | PBLYOYWUSAUJPD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 137.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |