C22H28O5Si2 — CID 528819
3-methoxy-2-phenyl-5,7-bis(trimethylsilyloxy)chromen-4-one (PubChem CID 528819) has the molecular formula C22H28O5Si2 and a molecular weight of 428.63 g/mol. Its IUPAC name is 3-methoxy-2-phenyl-5,7-bis(trimethylsilyloxy)chromen-4-one.
| Compound Name | 3-methoxy-2-phenyl-5,7-bis(trimethylsilyloxy)chromen-4-one |
|---|---|
| PubChem CID | 528819 |
| Molecular Formula | C22H28O5Si2 |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-methoxy-2-phenyl-5,7-bis(trimethylsilyloxy)chromen-4-one |
| SMILES | COc1c(-c2ccccc2)oc2cc(O[Si](C)(C)C)cc(O[Si](C)(C)C)c2c1=O |
| InChI | InChI=1S/C22H28O5Si2/c1-24-22-20(23)19-17(25-21(22)15-11-9-8-10-12-15)13-16(26-28(2,3)4)14-18(19)27-29(5,6)7/h8-14H,1-7H3 |
| InChIKey | CBJNUHFMFBPGCP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|