C44H36O8 — CID 142688399
5-hydroxy-3-methoxy-7-phenylmethoxy-2-[3,4,5-tris(phenylmethoxy)phenyl]chromen-4-one (PubChem CID 142688399) has the molecular formula C44H36O8 and a molecular weight of 692.76 g/mol. Its IUPAC name is 5-hydroxy-3-methoxy-7-phenylmethoxy-2-[3,4,5-tris(phenylmethoxy)phenyl]chromen-4-one.
| Compound Name | 5-hydroxy-3-methoxy-7-phenylmethoxy-2-[3,4,5-tris(phenylmethoxy)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 142688399 |
| Molecular Formula | C44H36O8 |
| Molecular Weight | 692.76 g/mol |
| Exact Mass | 692.24 |
| IUPAC Name | 5-hydroxy-3-methoxy-7-phenylmethoxy-2-[3,4,5-tris(phenylmethoxy)phenyl]chromen-4-one |
| SMILES | COc1c(-c2cc(OCc3ccccc3)c(OCc3ccccc3)c(OCc3ccccc3)c2)oc2cc(OCc3ccccc3)cc(O)c2c1=O |
| InChI | InChI=1S/C44H36O8/c1-47-44-41(46)40-36(45)24-35(48-26-30-14-6-2-7-15-30)25-37(40)52-42(44)34-22-38(49-27-31-16-8-3-9-17-31)43(51-29-33-20-12-5-13-21-33)39(23-34)50-28-32-18-10-4-11-19-32/h2-25,45H,26-29H2,1H3 |
| InChIKey | PLAZRLZRHQEOBS-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.76 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |