C27H22O5 — CID 135026810
5-hydroxy-7-(2-methylbut-3-yn-2-yloxy)-2-phenyl-3-phenylmethoxychromen-4-one (PubChem CID 135026810) has the molecular formula C27H22O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 5-hydroxy-7-(2-methylbut-3-yn-2-yloxy)-2-phenyl-3-phenylmethoxychromen-4-one.
| Compound Name | 5-hydroxy-7-(2-methylbut-3-yn-2-yloxy)-2-phenyl-3-phenylmethoxychromen-4-one |
|---|---|
| PubChem CID | 135026810 |
| Molecular Formula | C27H22O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 5-hydroxy-7-(2-methylbut-3-yn-2-yloxy)-2-phenyl-3-phenylmethoxychromen-4-one |
| SMILES | C#CC(C)(C)Oc1cc(O)c2c(=O)c(OCc3ccccc3)c(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C27H22O5/c1-4-27(2,3)32-20-15-21(28)23-22(16-20)31-25(19-13-9-6-10-14-19)26(24(23)29)30-17-18-11-7-5-8-12-18/h1,5-16,28H,17H2,2-3H3 |
| InChIKey | RSSSDAKXXYFILO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|