C29H22O7 — CID 11443055
2-(3,4-dihydroxyphenyl)-5-hydroxy-3,7-bis(phenylmethoxy)chromen-4-one (PubChem CID 11443055) has the molecular formula C29H22O7 and a molecular weight of 482.49 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,7-bis(phenylmethoxy)chromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,7-bis(phenylmethoxy)chromen-4-one |
|---|---|
| PubChem CID | 11443055 |
| Molecular Formula | C29H22O7 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,7-bis(phenylmethoxy)chromen-4-one |
| SMILES | O=c1c(OCc2ccccc2)c(-c2ccc(O)c(O)c2)oc2cc(OCc3ccccc3)cc(O)c12 |
| InChI | InChI=1S/C29H22O7/c30-22-12-11-20(13-23(22)31)28-29(35-17-19-9-5-2-6-10-19)27(33)26-24(32)14-21(15-25(26)36-28)34-16-18-7-3-1-4-8-18/h1-15,30-32H,16-17H2 |
| InChIKey | SUWZRJNANIQBFX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|