C17H12O9 — CID 44592336
2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxyacetic acid (PubChem CID 44592336) has the molecular formula C17H12O9 and a molecular weight of 360.27 g/mol. Its IUPAC name is 2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxyacetic acid.
| Compound Name | 2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 44592336 |
| Molecular Formula | C17H12O9 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxyacetic acid |
| SMILES | O=C(O)COc1c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C17H12O9/c18-8-4-11(21)14-12(5-8)26-16(7-1-2-9(19)10(20)3-7)17(15(14)24)25-6-13(22)23/h1-5,18-21H,6H2,(H,22,23) |
| InChIKey | QSZHINSNAWLWKL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|