C27H30O11 — CID 56955877
[2-(3,4-dihydroxyphenyl)-3-(2,2-dimethylpropanoyloxymethoxy)-5-hydroxy-4-oxochromen-7-yl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 56955877) has the molecular formula C27H30O11 and a molecular weight of 530.53 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-3-(2,2-dimethylpropanoyloxymethoxy)-5-hydroxy-4-oxochromen-7-yl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-(3,4-dihydroxyphenyl)-3-(2,2-dimethylpropanoyloxymethoxy)-5-hydroxy-4-oxochromen-7-yl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 56955877 |
| Molecular Formula | C27H30O11 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-3-(2,2-dimethylpropanoyloxymethoxy)-5-hydroxy-4-oxochromen-7-yl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOc1cc(O)c2c(=O)c(OCOC(=O)C(C)(C)C)c(-c3ccc(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C27H30O11/c1-26(2,3)24(32)36-12-34-15-10-18(30)20-19(11-15)38-22(14-7-8-16(28)17(29)9-14)23(21(20)31)35-13-37-25(33)27(4,5)6/h7-11,28-30H,12-13H2,1-6H3 |
| InChIKey | VIMBBZXTSZIZLJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 161.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|