C21H20O9 — CID 25154340
[2-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 25154340) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is [2-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [2-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 25154340 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [2-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)ccc1O |
| InChI | InChI=1S/C21H20O9/c1-21(2,3)20(27)29-9-28-14-6-10(4-5-12(14)23)19-18(26)17(25)16-13(24)7-11(22)8-15(16)30-19/h4-8,22-24,26H,9H2,1-3H3 |
| InChIKey | GYNWMFLTLMCTDD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|