C26H24O7 — CID 142714408
7-[(4-tert-butylphenyl)methoxy]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one (PubChem CID 142714408) has the molecular formula C26H24O7 and a molecular weight of 448.47 g/mol. Its IUPAC name is 7-[(4-tert-butylphenyl)methoxy]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one.
| Compound Name | 7-[(4-tert-butylphenyl)methoxy]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 142714408 |
| Molecular Formula | C26H24O7 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 7-[(4-tert-butylphenyl)methoxy]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one |
| SMILES | CC(C)(C)c1ccc(COc2cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc3c2)cc1 |
| InChI | InChI=1S/C26H24O7/c1-26(2,3)16-7-4-14(5-8-16)13-32-17-11-20(29)22-21(12-17)33-25(24(31)23(22)30)15-6-9-18(27)19(28)10-15/h4-12,27-29,31H,13H2,1-3H3 |
| InChIKey | CVDDDHHYEMTRCP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|