C29H22O6 — CID 12775837
3,5-dihydroxy-7-phenylmethoxy-2-(4-phenylmethoxyphenyl)chromen-4-one (PubChem CID 12775837) has the molecular formula C29H22O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is 3,5-dihydroxy-7-phenylmethoxy-2-(4-phenylmethoxyphenyl)chromen-4-one.
| Compound Name | 3,5-dihydroxy-7-phenylmethoxy-2-(4-phenylmethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 12775837 |
| Molecular Formula | C29H22O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 3,5-dihydroxy-7-phenylmethoxy-2-(4-phenylmethoxyphenyl)chromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(OCc3ccccc3)cc2)oc2cc(OCc3ccccc3)cc(O)c12 |
| InChI | InChI=1S/C29H22O6/c30-24-15-23(34-18-20-9-5-2-6-10-20)16-25-26(24)27(31)28(32)29(35-25)21-11-13-22(14-12-21)33-17-19-7-3-1-4-8-19/h1-16,30,32H,17-18H2 |
| InChIKey | DONNDJBIKGUZDG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |