C42H38O16 — CID 11571404
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-(3,5-dihydroxy-4-oxo-7-phenylmethoxychromen-2-yl)-2-phenylmethoxyphenoxy]oxane-2-carboxylate (PubChem CID 11571404) has the molecular formula C42H38O16 and a molecular weight of 798.75 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-(3,5-dihydroxy-4-oxo-7-phenylmethoxychromen-2-yl)-2-phenylmethoxyphenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-(3,5-dihydroxy-4-oxo-7-phenylmethoxychromen-2-yl)-2-phenylmethoxyphenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11571404 |
| Molecular Formula | C42H38O16 |
| Molecular Weight | 798.75 g/mol |
| Exact Mass | 798.22 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-(3,5-dihydroxy-4-oxo-7-phenylmethoxychromen-2-yl)-2-phenylmethoxyphenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2cc(-c3oc4cc(OCc5ccccc5)cc(O)c4c(=O)c3O)ccc2OCc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C42H38O16/c1-22(43)53-37-38(54-23(2)44)40(55-24(3)45)42(58-39(37)41(49)50-4)57-31-17-27(15-16-30(31)52-21-26-13-9-6-10-14-26)36-35(48)34(47)33-29(46)18-28(19-32(33)56-36)51-20-25-11-7-5-8-12-25/h5-19,37-40,42,46,48H,20-21H2,1-4H3/t37-,38-,39-,40+,42+/m0/s1 |
| InChIKey | UYQOTRNLHSBZTP-NBXDISJVSA-N |
| XLogP | 5.10 |
| TPSA | 212.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|