C28H28O13 — CID 170180708
methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-formyl-2-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate (PubChem CID 170180708) has the molecular formula C28H28O13 and a molecular weight of 572.52 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-formyl-2-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-formyl-2-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 170180708 |
| Molecular Formula | C28H28O13 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-formyl-2-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C=O)cc2C(=O)OCc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H28O13/c1-15(30)37-22-23(38-16(2)31)25(39-17(3)32)28(41-24(22)27(34)35-4)40-21-11-10-19(13-29)12-20(21)26(33)36-14-18-8-6-5-7-9-18/h5-13,22-25,28H,14H2,1-4H3/t22-,23+,24+,25-,28-/m1/s1 |
| InChIKey | IQEUOSCWOINFPG-LKNBFUSASA-N |
| XLogP | 1.93 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|