C26H36N2O12 — CID 129152393
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-methyl-4-[[methyl-[2-(methylamino)ethyl]carbamoyl]oxymethyl]phenoxy]oxane-2-carboxylate (PubChem CID 129152393) has the molecular formula C26H36N2O12 and a molecular weight of 568.58 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-methyl-4-[[methyl-[2-(methylamino)ethyl]carbamoyl]oxymethyl]phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-methyl-4-[[methyl-[2-(methylamino)ethyl]carbamoyl]oxymethyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 129152393 |
| Molecular Formula | C26H36N2O12 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-methyl-4-[[methyl-[2-(methylamino)ethyl]carbamoyl]oxymethyl]phenoxy]oxane-2-carboxylate |
| SMILES | CNCCN(C)C(=O)OCc1ccc(O[C@@H]2O[C@H](C(=O)OC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(C)c1 |
| InChI | InChI=1S/C26H36N2O12/c1-14-12-18(13-35-26(33)28(6)11-10-27-5)8-9-19(14)39-25-23(38-17(4)31)21(37-16(3)30)20(36-15(2)29)22(40-25)24(32)34-7/h8-9,12,20-23,25,27H,10-11,13H2,1-7H3/t20-,21-,22-,23+,25+/m0/s1 |
| InChIKey | MYTCYMTVHXONNL-FPDJOHNTSA-N |
| XLogP | 0.85 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|