C34H45N3O12S — CID 163428458
methyl (4S,6R)-3,4,5-triacetyloxy-6-[2-amino-4-[[2-(dimethylamino)ethyl-(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]oxane-2-carboxylate (PubChem CID 163428458) has the molecular formula C34H45N3O12S and a molecular weight of 719.81 g/mol. Its IUPAC name is methyl (4S,6R)-3,4,5-triacetyloxy-6-[2-amino-4-[[2-(dimethylamino)ethyl-(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (4S,6R)-3,4,5-triacetyloxy-6-[2-amino-4-[[2-(dimethylamino)ethyl-(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 163428458 |
| Molecular Formula | C34H45N3O12S |
| Molecular Weight | 719.81 g/mol |
| Exact Mass | 719.27 |
| IUPAC Name | methyl (4S,6R)-3,4,5-triacetyloxy-6-[2-amino-4-[[2-(dimethylamino)ethyl-(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)C1O[C@H](Oc2ccc(COC(=O)N(CCN(C)C)CSCCc3ccccc3)cc2N)C(OC(C)=O)[C@@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C34H45N3O12S/c1-21(38)45-28-29(46-22(2)39)31(47-23(3)40)33(49-30(28)32(41)43-6)48-27-13-12-25(18-26(27)35)19-44-34(42)37(16-15-36(4)5)20-50-17-14-24-10-8-7-9-11-24/h7-13,18,28-31,33H,14-17,19-20,35H2,1-6H3/t28?,29-,30?,31?,33-/m0/s1 |
| InChIKey | AOMVAYVMEZQADT-VSCVHJNGSA-N |
| XLogP | 2.77 |
| TPSA | 182.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.81 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|