C30H40N2O10S — CID 144872505
(4R)-6-[2-acetamido-4-[[ethyl(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]-3-hydroxy-5-(2-hydroxyethoxy)-4-methyloxane-2-carboxylic acid (PubChem CID 144872505) has the molecular formula C30H40N2O10S and a molecular weight of 620.72 g/mol. Its IUPAC name is (4R)-6-[2-acetamido-4-[[ethyl(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]-3-hydroxy-5-(2-hydroxyethoxy)-4-methyloxane-2-carboxylic acid.
| Compound Name | (4R)-6-[2-acetamido-4-[[ethyl(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]-3-hydroxy-5-(2-hydroxyethoxy)-4-methyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 144872505 |
| Molecular Formula | C30H40N2O10S |
| Molecular Weight | 620.72 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | (4R)-6-[2-acetamido-4-[[ethyl(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]-3-hydroxy-5-(2-hydroxyethoxy)-4-methyloxane-2-carboxylic acid |
| SMILES | CCN(CSCCc1ccccc1)C(=O)OCc1ccc(OC2OC(C(=O)O)C(O)[C@@H](C)C2OCCO)c(NC(C)=O)c1 |
| InChI | InChI=1S/C30H40N2O10S/c1-4-32(18-43-15-12-21-8-6-5-7-9-21)30(38)40-17-22-10-11-24(23(16-22)31-20(3)34)41-29-26(39-14-13-33)19(2)25(35)27(42-29)28(36)37/h5-11,16,19,25-27,29,33,35H,4,12-15,17-18H2,1-3H3,(H,31,34)(H,36,37)/t19-,25?,26?,27?,29?/m1/s1 |
| InChIKey | IOKOOUASNXQYBH-KSNCTTHNSA-N |
| XLogP | 3.10 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.72 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|