C20H27NO10 — CID 162024797
6-[4-(deuteriocarbonyloxymethyl)-2-(hexanoylamino)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 162024797) has the molecular formula C20H27NO10 and a molecular weight of 442.44 g/mol. Its IUPAC name is 6-[4-(deuteriocarbonyloxymethyl)-2-(hexanoylamino)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[4-(deuteriocarbonyloxymethyl)-2-(hexanoylamino)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162024797 |
| Molecular Formula | C20H27NO10 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 6-[4-(deuteriocarbonyloxymethyl)-2-(hexanoylamino)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | [2H]C(=O)OCc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)c(NC(=O)CCCCC)c1 |
| InChI | InChI=1S/C20H27NO10/c1-2-3-4-5-14(23)21-12-8-11(9-29-10-22)6-7-13(12)30-20-17(26)15(24)16(25)18(31-20)19(27)28/h6-8,10,15-18,20,24-26H,2-5,9H2,1H3,(H,21,23)(H,27,28)/i10D |
| InChIKey | YVFQFVRHOSFNAQ-MMIHMFRQSA-N |
| XLogP | 0.15 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|