C22H32N2O9 — CID 166799703
(2S,3S,4S,5R,6S)-6-[2-[3-(butanoylamino)propanoylamino]-4-propylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 166799703) has the molecular formula C22H32N2O9 and a molecular weight of 468.50 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[2-[3-(butanoylamino)propanoylamino]-4-propylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[2-[3-(butanoylamino)propanoylamino]-4-propylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 166799703 |
| Molecular Formula | C22H32N2O9 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[2-[3-(butanoylamino)propanoylamino]-4-propylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCCC(=O)NCCC(=O)Nc1cc(CCC)ccc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H32N2O9/c1-3-5-12-7-8-14(13(11-12)24-16(26)9-10-23-15(25)6-4-2)32-22-19(29)17(27)18(28)20(33-22)21(30)31/h7-8,11,17-20,22,27-29H,3-6,9-10H2,1-2H3,(H,23,25)(H,24,26)(H,30,31)/t17-,18-,19+,20-,22+/m0/s1 |
| InChIKey | YAGFDWCODPNYPA-SXFAUFNYSA-N |
| XLogP | 0.16 |
| TPSA | 174.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |