C28H35N3O16 — CID 159315190
(2S,3S,4S,5R,6S)-6-[4-(acetyloxymethyl)-2-[3-[3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoylamino]propanoylamino]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 159315190) has the molecular formula C28H35N3O16 and a molecular weight of 669.59 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[4-(acetyloxymethyl)-2-[3-[3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoylamino]propanoylamino]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[4-(acetyloxymethyl)-2-[3-[3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoylamino]propanoylamino]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 159315190 |
| Molecular Formula | C28H35N3O16 |
| Molecular Weight | 669.59 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-(acetyloxymethyl)-2-[3-[3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoylamino]propanoylamino]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(=O)OCc1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c(NC(=O)CCNC(=O)CCOCCC(=O)ON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C28H35N3O16/c1-14(32)44-13-15-2-3-17(45-28-25(40)23(38)24(39)26(46-28)27(41)42)16(12-15)30-19(34)6-9-29-18(33)7-10-43-11-8-22(37)47-31-20(35)4-5-21(31)36/h2-3,12,23-26,28,38-40H,4-11,13H2,1H3,(H,29,33)(H,30,34)(H,41,42)/t23-,24-,25+,26-,28+/m0/s1 |
| InChIKey | UENNYDZEHRYTPM-NLMMERCGSA-N |
| XLogP | -2.13 |
| TPSA | 273.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.59 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|