C32H49N3O14 — CID 171065768
[4-[(3R,5S)-3,5-dihydroxyoxan-2-yl]oxy-3-[3-[3-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]ethoxy]propanoylamino]propanoylamino]phenyl]methyl acetate;ethane;formic acid (PubChem CID 171065768) has the molecular formula C32H49N3O14 and a molecular weight of 699.75 g/mol. Its IUPAC name is [4-[(3R,5S)-3,5-dihydroxyoxan-2-yl]oxy-3-[3-[3-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]ethoxy]propanoylamino]propanoylamino]phenyl]methyl acetate;ethane;formic acid.
| Compound Name | [4-[(3R,5S)-3,5-dihydroxyoxan-2-yl]oxy-3-[3-[3-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]ethoxy]propanoylamino]propanoylamino]phenyl]methyl acetate;ethane;formic acid |
|---|---|
| PubChem CID | 171065768 |
| Molecular Formula | C32H49N3O14 |
| Molecular Weight | 699.75 g/mol |
| Exact Mass | 699.32 |
| IUPAC Name | [4-[(3R,5S)-3,5-dihydroxyoxan-2-yl]oxy-3-[3-[3-[2-[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)ethoxy]ethoxy]propanoylamino]propanoylamino]phenyl]methyl acetate;ethane;formic acid |
| SMILES | CC.CC(=O)OCc1ccc(OC2OC[C@@H](O)C[C@H]2O)c(NC(=O)CCNC(=O)CCOCCOCCN2C(=O)CC(C)C2=O)c1.O=CO |
| InChI | InChI=1S/C29H41N3O12.C2H6.CH2O2/c1-18-13-27(38)32(28(18)39)8-10-41-12-11-40-9-6-25(36)30-7-5-26(37)31-22-14-20(16-42-19(2)33)3-4-24(22)44-29-23(35)15-21(34)17-43-29;1-2;2-1-3/h3-4,14,18,21,23,29,34-35H,5-13,15-17H2,1-2H3,(H,30,36)(H,31,37);1-2H3;1H,(H,2,3)/t18?,21-,23+,29?;;/m0../s1 |
| InChIKey | SVSMLSRWEIMSGB-HNLPHKEHSA-N |
| XLogP | 0.59 |
| TPSA | 236.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.75 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|