C31H43N3O13 — CID 140909389
[3-[3-[3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoylamino]propanoylamino]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate (PubChem CID 140909389) has the molecular formula C31H43N3O13 and a molecular weight of 665.69 g/mol. Its IUPAC name is [3-[3-[3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoylamino]propanoylamino]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [3-[3-[3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoylamino]propanoylamino]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 140909389 |
| Molecular Formula | C31H43N3O13 |
| Molecular Weight | 665.69 g/mol |
| Exact Mass | 665.28 |
| IUPAC Name | [3-[3-[3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoylamino]propanoylamino]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ccc(O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c(NC(=O)CCNC(=O)CCOCCOCCN2C(=O)C=CC2=O)c1 |
| InChI | InChI=1S/C31H43N3O13/c1-31(2,3)30(42)46-17-19-4-5-22(47-29-28(41)27(40)21(35)18-45-29)20(16-19)33-24(37)8-10-32-23(36)9-12-43-14-15-44-13-11-34-25(38)6-7-26(34)39/h4-7,16,21,27-29,35,40-41H,8-15,17-18H2,1-3H3,(H,32,36)(H,33,37)/t21-,27+,28-,29+/m1/s1 |
| InChIKey | HPXBYVHPQFIWMJ-UQMGHXSLSA-N |
| XLogP | -0.61 |
| TPSA | 219.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.69 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|