C28H42N2O11S — CID 140909401
[3-[3-(6-ethenylsulfonylhexanoylamino)propanoylamino]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate (PubChem CID 140909401) has the molecular formula C28H42N2O11S and a molecular weight of 614.71 g/mol. Its IUPAC name is [3-[3-(6-ethenylsulfonylhexanoylamino)propanoylamino]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [3-[3-(6-ethenylsulfonylhexanoylamino)propanoylamino]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 140909401 |
| Molecular Formula | C28H42N2O11S |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | [3-[3-(6-ethenylsulfonylhexanoylamino)propanoylamino]-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CS(=O)(=O)CCCCCC(=O)NCCC(=O)Nc1cc(COC(=O)C(C)(C)C)ccc1O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H42N2O11S/c1-5-42(37,38)14-8-6-7-9-22(32)29-13-12-23(33)30-19-15-18(16-40-27(36)28(2,3)4)10-11-21(19)41-26-25(35)24(34)20(31)17-39-26/h5,10-11,15,20,24-26,31,34-35H,1,6-9,12-14,16-17H2,2-4H3,(H,29,32)(H,30,33)/t20-,24+,25-,26+/m1/s1 |
| InChIKey | NRIPLUBTGJUNOE-ZFILCQGISA-N |
| XLogP | 1.16 |
| TPSA | 197.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|