C28H43N3O10S — CID 145416654
(5R)-6-[4-(acetyloxymethyl)-2-[3-[6-(ethenylsulfanylamino)hexanoylamino]propanoylamino]phenoxy]-4,5-dihydroxyoxane-2-carboxylic acid;ethane (PubChem CID 145416654) has the molecular formula C28H43N3O10S and a molecular weight of 613.73 g/mol. Its IUPAC name is (5R)-6-[4-(acetyloxymethyl)-2-[3-[6-(ethenylsulfanylamino)hexanoylamino]propanoylamino]phenoxy]-4,5-dihydroxyoxane-2-carboxylic acid;ethane.
| Compound Name | (5R)-6-[4-(acetyloxymethyl)-2-[3-[6-(ethenylsulfanylamino)hexanoylamino]propanoylamino]phenoxy]-4,5-dihydroxyoxane-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145416654 |
| Molecular Formula | C28H43N3O10S |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | (5R)-6-[4-(acetyloxymethyl)-2-[3-[6-(ethenylsulfanylamino)hexanoylamino]propanoylamino]phenoxy]-4,5-dihydroxyoxane-2-carboxylic acid;ethane |
| SMILES | C=CSNCCCCCC(=O)NCCC(=O)Nc1cc(COC(C)=O)ccc1OC1OC(C(=O)O)CC(O)[C@H]1O.CC |
| InChI | InChI=1S/C26H37N3O10S.C2H6/c1-3-40-28-11-6-4-5-7-22(32)27-12-10-23(33)29-18-13-17(15-37-16(2)30)8-9-20(18)38-26-24(34)19(31)14-21(39-26)25(35)36;1-2/h3,8-9,13,19,21,24,26,28,31,34H,1,4-7,10-12,14-15H2,2H3,(H,27,32)(H,29,33)(H,35,36);1-2H3/t19?,21?,24-,26?;/m1./s1 |
| InChIKey | VISSSMUVGQCTJP-BUXCIXMWSA-N |
| XLogP | 2.46 |
| TPSA | 192.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|