C23H36O6 — CID 157332702
[4-[(2R,3R,4R,5R)-4,5-dihydroxy-3-methyloxan-2-yl]oxy-3-(2,2-dimethylpropyl)phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 157332702) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is [4-[(2R,3R,4R,5R)-4,5-dihydroxy-3-methyloxan-2-yl]oxy-3-(2,2-dimethylpropyl)phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[(2R,3R,4R,5R)-4,5-dihydroxy-3-methyloxan-2-yl]oxy-3-(2,2-dimethylpropyl)phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 157332702 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [4-[(2R,3R,4R,5R)-4,5-dihydroxy-3-methyloxan-2-yl]oxy-3-(2,2-dimethylpropyl)phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | C[C@H]1[C@@H](Oc2ccc(COC(=O)C(C)(C)C)cc2CC(C)(C)C)OC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H36O6/c1-14-19(25)17(24)13-27-20(14)29-18-9-8-15(10-16(18)11-22(2,3)4)12-28-21(26)23(5,6)7/h8-10,14,17,19-20,24-25H,11-13H2,1-7H3/t14-,17-,19-,20-/m1/s1 |
| InChIKey | WOBUHMGSKKGLOU-SJFSSXKUSA-N |
| XLogP | 3.46 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |