C13H17NO7 — CID 130186746
[3-amino-4-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl deuterioformate (PubChem CID 130186746) has the molecular formula C13H17NO7 and a molecular weight of 300.29 g/mol. Its IUPAC name is [3-amino-4-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl deuterioformate.
| Compound Name | [3-amino-4-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl deuterioformate |
|---|---|
| PubChem CID | 130186746 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [3-amino-4-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl deuterioformate |
| SMILES | [2H]C(=O)OCc1ccc(OC2OC[C@@H](O)[C@H](O)[C@H]2O)c(N)c1 |
| InChI | InChI=1S/C13H17NO7/c14-8-3-7(4-19-6-15)1-2-10(8)21-13-12(18)11(17)9(16)5-20-13/h1-3,6,9,11-13,16-18H,4-5,14H2/t9-,11+,12-,13?/m1/s1/i6D |
| InChIKey | SFNLLPQTUIDJBV-LSSCMSMOSA-N |
| XLogP | -1.24 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|