C13H17BNO7 — CID 176697532
CID 176697532 (PubChem CID 176697532) has the molecular formula C13H17BNO7 and a molecular weight of 310.09 g/mol.
| Compound Name | CID 176697532 |
|---|---|
| PubChem CID | 176697532 |
| Molecular Formula | C13H17BNO7 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | — |
| SMILES | [BH]Cc1ccc(OC2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c(N)c1 |
| InChI | InChI=1S/C13H17BNO7/c14-4-5-1-2-7(6(15)3-5)21-13-10(18)8(16)9(17)11(22-13)12(19)20/h1-3,8-11,13-14,16-18H,4,15H2,(H,19,20)/t8-,9-,10+,11-,13?/m0/s1 |
| InChIKey | NQUHNJLESKONHZ-NJMOVEGISA-N |
| XLogP | -2.06 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|