C13H17NO8S — CID 144871108
3,4,5-trihydroxy-6-[4-(hydroxymethyl)-2-(sulfanylamino)phenoxy]oxane-2-carboxylic acid (PubChem CID 144871108) has the molecular formula C13H17NO8S and a molecular weight of 347.35 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[4-(hydroxymethyl)-2-(sulfanylamino)phenoxy]oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[4-(hydroxymethyl)-2-(sulfanylamino)phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 144871108 |
| Molecular Formula | C13H17NO8S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 3,4,5-trihydroxy-6-[4-(hydroxymethyl)-2-(sulfanylamino)phenoxy]oxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(Oc2ccc(CO)cc2NS)C(O)C(O)C1O |
| InChI | InChI=1S/C13H17NO8S/c15-4-5-1-2-7(6(3-5)14-23)21-13-10(18)8(16)9(17)11(22-13)12(19)20/h1-3,8-11,13-18,23H,4H2,(H,19,20) |
| InChIKey | PXAQZPRCYUSMOU-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|