C14H18O7 — CID 131831705
6-(4-ethylphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 131831705) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is 6-(4-ethylphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(4-ethylphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131831705 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 6-(4-ethylphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C14H18O7/c1-2-7-3-5-8(6-4-7)20-14-11(17)9(15)10(16)12(21-14)13(18)19/h3-6,9-12,14-17H,2H2,1H3,(H,18,19) |
| InChIKey | VCVXAAYLLIDUGA-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |