C12H14NO9- — CID 163153902
3,4,5-trihydroxy-6-[4-[hydroxy(oxido)amino]phenoxy]oxane-2-carboxylic acid (PubChem CID 163153902) has the molecular formula C12H14NO9- and a molecular weight of 316.24 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[4-[hydroxy(oxido)amino]phenoxy]oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[4-[hydroxy(oxido)amino]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163153902 |
| Molecular Formula | C12H14NO9- |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3,4,5-trihydroxy-6-[4-[hydroxy(oxido)amino]phenoxy]oxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(Oc2ccc(N([O-])O)cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C12H14NO9/c14-7-8(15)10(11(17)18)22-12(9(7)16)21-6-3-1-5(2-4-6)13(19)20/h1-4,7-10,12,14-16,19H,(H,17,18)/q-1 |
| InChIKey | OZTBLHCSHHIKAH-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|