C12H14O7 — CID 133124983
(3R,6S)-3,4,5-trihydroxy-6-phenoxyoxane-2-carboxylic acid (PubChem CID 133124983) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is (3R,6S)-3,4,5-trihydroxy-6-phenoxyoxane-2-carboxylic acid.
| Compound Name | (3R,6S)-3,4,5-trihydroxy-6-phenoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 133124983 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (3R,6S)-3,4,5-trihydroxy-6-phenoxyoxane-2-carboxylic acid |
| SMILES | O=C(O)C1O[C@@H](Oc2ccccc2)C(O)C(O)[C@H]1O |
| InChI | InChI=1S/C12H14O7/c13-7-8(14)10(11(16)17)19-12(9(7)15)18-6-4-2-1-3-5-6/h1-5,7-10,12-15H,(H,16,17)/t7?,8-,9?,10?,12-/m1/s1 |
| InChIKey | WVHAUDNUGBNUDZ-COMDKTKNSA-N |
| XLogP | -1.04 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |