C16H16NaO7+ — CID 130476793
sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-naphthalen-2-yloxyoxane-2-carboxylic acid (PubChem CID 130476793) has the molecular formula C16H16NaO7+ and a molecular weight of 343.29 g/mol. Its IUPAC name is sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-naphthalen-2-yloxyoxane-2-carboxylic acid.
| Compound Name | sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-naphthalen-2-yloxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 130476793 |
| Molecular Formula | C16H16NaO7+ |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-naphthalen-2-yloxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2ccc3ccccc3c2)[C@H](O)[C@@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C16H16O7.Na/c17-11-12(18)14(15(20)21)23-16(13(11)19)22-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7,11-14,16-19H,(H,20,21);/q;+1/t11-,12-,13+,14-,16+;/m0./s1 |
| InChIKey | RLXOGFBMVJVJBH-YYHOVTOASA-N |
| XLogP | -2.89 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |