C21H20O8 — CID 131839035
3,4,5-trihydroxy-6-[3-[(E)-3-phenylprop-2-enoyl]phenoxy]oxane-2-carboxylic acid (PubChem CID 131839035) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[3-[(E)-3-phenylprop-2-enoyl]phenoxy]oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[3-[(E)-3-phenylprop-2-enoyl]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131839035 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3,4,5-trihydroxy-6-[3-[(E)-3-phenylprop-2-enoyl]phenoxy]oxane-2-carboxylic acid |
| SMILES | O=C(/C=C/c1ccccc1)c1cccc(OC2OC(C(=O)O)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C21H20O8/c22-15(10-9-12-5-2-1-3-6-12)13-7-4-8-14(11-13)28-21-18(25)16(23)17(24)19(29-21)20(26)27/h1-11,16-19,21,23-25H,(H,26,27)/b10-9+ |
| InChIKey | TWTQVIQWCKRMHD-MDZDMXLPSA-N |
| XLogP | 0.85 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|