C21H22O7 — CID 23144947
(E)-3-phenyl-1-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one (PubChem CID 23144947) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is (E)-3-phenyl-1-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-3-phenyl-1-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 23144947 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (E)-3-phenyl-1-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)c1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C21H22O7/c22-12-17-18(24)19(25)20(26)21(28-17)27-15-9-7-14(8-10-15)16(23)11-6-13-4-2-1-3-5-13/h1-11,17-22,24-26H,12H2/b11-6+ |
| InChIKey | OWEQIVOUCFSICJ-IZZDOVSWSA-N |
| XLogP | 0.76 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|