C23H27BrO8 — CID 139077109
(E)-1-(4-bromophenyl)-3-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one;ethanol (PubChem CID 139077109) has the molecular formula C23H27BrO8 and a molecular weight of 511.37 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one;ethanol.
| Compound Name | (E)-1-(4-bromophenyl)-3-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one;ethanol |
|---|---|
| PubChem CID | 139077109 |
| Molecular Formula | C23H27BrO8 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one;ethanol |
| SMILES | CCO.O=C(/C=C/c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H21BrO7.C2H6O/c22-14-6-4-13(5-7-14)16(24)10-3-12-1-8-15(9-2-12)28-21-20(27)19(26)18(25)17(11-23)29-21;1-2-3/h1-10,17-21,23,25-27H,11H2;3H,2H2,1H3/b10-3+;/t17-,18-,19-,20-,21-;/m1./s1 |
| InChIKey | LEOQSRUOVREJAA-HSHZMOFQSA-N |
| XLogP | 1.52 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|