C16H23NO7 — CID 121405401
3,4,5-trihydroxy-6-[4-(propylaminomethyl)phenoxy]oxane-2-carboxylic acid (PubChem CID 121405401) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[4-(propylaminomethyl)phenoxy]oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[4-(propylaminomethyl)phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 121405401 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3,4,5-trihydroxy-6-[4-(propylaminomethyl)phenoxy]oxane-2-carboxylic acid |
| SMILES | CCCNCc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C16H23NO7/c1-2-7-17-8-9-3-5-10(6-4-9)23-16-13(20)11(18)12(19)14(24-16)15(21)22/h3-6,11-14,16-20H,2,7-8H2,1H3,(H,21,22) |
| InChIKey | JWELEBJBHWASEB-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|