C23H32O10 — CID 171745136
[3-(2,2-dimethylpropanoyl)-4-[(2R,3R,4R,5S)-6-formyloxy-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate (PubChem CID 171745136) has the molecular formula C23H32O10 and a molecular weight of 468.50 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoyl)-4-[(2R,3R,4R,5S)-6-formyloxy-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [3-(2,2-dimethylpropanoyl)-4-[(2R,3R,4R,5S)-6-formyloxy-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171745136 |
| Molecular Formula | C23H32O10 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | [3-(2,2-dimethylpropanoyl)-4-[(2R,3R,4R,5S)-6-formyloxy-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ccc(O[C@@H]2OC(OC=O)[C@@H](O)[C@H](O)[C@H]2O)c(C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H32O10/c1-22(2,3)18(28)13-9-12(10-30-21(29)23(4,5)6)7-8-14(13)32-20-17(27)15(25)16(26)19(33-20)31-11-24/h7-9,11,15-17,19-20,25-27H,10H2,1-6H3/t15-,16-,17+,19?,20+/m0/s1 |
| InChIKey | OHUCFFXPIJNQNF-WSLTXTJYSA-N |
| XLogP | 1.32 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|