C18H24N2O11 — CID 138650520
(2S,3S,4S,5R,6S)-6-[4-(acetyloxymethyl)-2-(2-aminooxyethylcarbamoyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 138650520) has the molecular formula C18H24N2O11 and a molecular weight of 444.39 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[4-(acetyloxymethyl)-2-(2-aminooxyethylcarbamoyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[4-(acetyloxymethyl)-2-(2-aminooxyethylcarbamoyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 138650520 |
| Molecular Formula | C18H24N2O11 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-(acetyloxymethyl)-2-(2-aminooxyethylcarbamoyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(=O)OCc1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c(C(=O)NCCON)c1 |
| InChI | InChI=1S/C18H24N2O11/c1-8(21)28-7-9-2-3-11(10(6-9)16(25)20-4-5-29-19)30-18-14(24)12(22)13(23)15(31-18)17(26)27/h2-3,6,12-15,18,22-24H,4-5,7,19H2,1H3,(H,20,25)(H,26,27)/t12-,13-,14+,15-,18+/m0/s1 |
| InChIKey | MZMYGHWHNYLLDC-PYOGLGTISA-N |
| XLogP | -2.36 |
| TPSA | 207.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|