C45H63B2N3O23 — CID 156628702
CID 156628702 (PubChem CID 156628702) has the molecular formula C45H63B2N3O23 and a molecular weight of 1035.62 g/mol.
| Compound Name | CID 156628702 |
|---|---|
| PubChem CID | 156628702 |
| Molecular Formula | C45H63B2N3O23 |
| Molecular Weight | 1035.62 g/mol |
| Exact Mass | 1035.40 |
| IUPAC Name | — |
| SMILES | [B]C(=O)OCc1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c(C(=O)NCCOCCN(CCOCCNC(=O)c2cc(COC([B])=O)ccc2O[C@@H]2O[C@H](O)[C@@H](O)[C@H](O)[C@H]2O)CCOCCOC(C)(C)C)c1 |
| InChI | InChI=1S/C45H63B2N3O23/c1-45(2,3)69-19-18-66-17-12-50(11-16-65-14-9-49-38(58)27-21-25(23-68-44(47)63)5-7-29(27)71-42-35(56)31(52)33(54)40(61)73-42)10-15-64-13-8-48-37(57)26-20-24(22-67-43(46)62)4-6-28(26)70-41-34(55)30(51)32(53)36(72-41)39(59)60/h4-7,20-21,30-36,40-42,51-56,61H,8-19,22-23H2,1-3H3,(H,48,57)(H,49,58)(H,59,60)/t30-,31-,32-,33-,34+,35+,36-,40-,41+,42+/m0/s1 |
| InChIKey | YPEDHNRAKHFPAR-JAOHBONASA-N |
| XLogP | -2.97 |
| TPSA | 366.79 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.62 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|