C32H45NO10 — CID 158945743
[4-[11-(2,5-dioxopyrrol-1-yl)-6-oxoundecyl]-2-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate (PubChem CID 158945743) has the molecular formula C32H45NO10 and a molecular weight of 603.71 g/mol. Its IUPAC name is [4-[11-(2,5-dioxopyrrol-1-yl)-6-oxoundecyl]-2-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[11-(2,5-dioxopyrrol-1-yl)-6-oxoundecyl]-2-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 158945743 |
| Molecular Formula | C32H45NO10 |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 603.30 |
| IUPAC Name | [4-[11-(2,5-dioxopyrrol-1-yl)-6-oxoundecyl]-2-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ccc(CCCCCC(=O)CCCCCN2C(=O)C=CC2=O)cc1O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C32H45NO10/c1-32(2,3)31(40)42-19-22-14-13-21(18-25(22)43-30-29(39)28(38)24(35)20-41-30)10-6-4-7-11-23(34)12-8-5-9-17-33-26(36)15-16-27(33)37/h13-16,18,24,28-30,35,38-39H,4-12,17,19-20H2,1-3H3/t24-,28+,29-,30+/m1/s1 |
| InChIKey | HBXOWOUFNYDNSL-AYYXBPQESA-N |
| XLogP | 2.75 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|