C25H34N2O9 — CID 163935368
(2S,3S,4S,5R,6S)-6-[2-(butanoylamino)-4-[1-(4-methylpenta-1,3-dien-2-ylamino)ethenoxymethyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163935368) has the molecular formula C25H34N2O9 and a molecular weight of 506.55 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[2-(butanoylamino)-4-[1-(4-methylpenta-1,3-dien-2-ylamino)ethenoxymethyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[2-(butanoylamino)-4-[1-(4-methylpenta-1,3-dien-2-ylamino)ethenoxymethyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163935368 |
| Molecular Formula | C25H34N2O9 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[2-(butanoylamino)-4-[1-(4-methylpenta-1,3-dien-2-ylamino)ethenoxymethyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | C=C(C=C(C)C)NC(=C)OCc1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c(NC(=O)CCC)c1 |
| InChI | InChI=1S/C25H34N2O9/c1-6-7-19(28)27-17-11-16(12-34-15(5)26-14(4)10-13(2)3)8-9-18(17)35-25-22(31)20(29)21(30)23(36-25)24(32)33/h8-11,20-23,25-26,29-31H,4-7,12H2,1-3H3,(H,27,28)(H,32,33)/t20-,21-,22+,23-,25+/m0/s1 |
| InChIKey | RMHUQLGBWLAVNS-LYVDORBWSA-N |
| XLogP | 1.75 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|