C27H34N2O10S — CID 122615073
(2S,3S,4S,5R,6S)-6-[2-acetamido-4-[[ethyl(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 122615073) has the molecular formula C27H34N2O10S and a molecular weight of 578.64 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[2-acetamido-4-[[ethyl(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[2-acetamido-4-[[ethyl(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 122615073 |
| Molecular Formula | C27H34N2O10S |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[2-acetamido-4-[[ethyl(2-phenylethylsulfanylmethyl)carbamoyl]oxymethyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCN(CSCCc1ccccc1)C(=O)OCc1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c(NC(C)=O)c1 |
| InChI | InChI=1S/C27H34N2O10S/c1-3-29(15-40-12-11-17-7-5-4-6-8-17)27(36)37-14-18-9-10-20(19(13-18)28-16(2)30)38-26-23(33)21(31)22(32)24(39-26)25(34)35/h4-10,13,21-24,26,31-33H,3,11-12,14-15H2,1-2H3,(H,28,30)(H,34,35)/t21-,22-,23+,24-,26+/m0/s1 |
| InChIKey | DRBCMVSJCXGGRD-TYUWDEHNSA-N |
| XLogP | 1.81 |
| TPSA | 175.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|