C22H27NO11 — CID 121376413
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-[(E)-3-hydroxyprop-1-enyl]phenoxy]oxane-2-carboxylate (PubChem CID 121376413) has the molecular formula C22H27NO11 and a molecular weight of 481.45 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-[(E)-3-hydroxyprop-1-enyl]phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-[(E)-3-hydroxyprop-1-enyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 121376413 |
| Molecular Formula | C22H27NO11 |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-amino-4-[(E)-3-hydroxyprop-1-enyl]phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(/C=C/CO)cc2N)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H27NO11/c1-11(25)30-17-18(31-12(2)26)20(32-13(3)27)22(34-19(17)21(28)29-4)33-16-8-7-14(6-5-9-24)10-15(16)23/h5-8,10,17-20,22,24H,9,23H2,1-4H3/b6-5+/t17-,18-,19-,20+,22+/m0/s1 |
| InChIKey | GWIRVQIIMCHKBJ-YGEBKBOMSA-N |
| XLogP | 0.35 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|