C19H20FNO12 — CID 11102791
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-fluoro-4-nitrophenoxy)oxane-2-carboxylate (PubChem CID 11102791) has the molecular formula C19H20FNO12 and a molecular weight of 473.36 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-fluoro-4-nitrophenoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-fluoro-4-nitrophenoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 11102791 |
| Molecular Formula | C19H20FNO12 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-fluoro-4-nitrophenoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc([N+](=O)[O-])cc2F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H20FNO12/c1-8(22)29-14-15(30-9(2)23)17(31-10(3)24)19(33-16(14)18(25)28-4)32-13-6-5-11(21(26)27)7-12(13)20/h5-7,14-17,19H,1-4H3/t14-,15-,16-,17+,19+/m0/s1 |
| InChIKey | GTYVNXJHDJRDMQ-YTGMWSOZSA-N |
| XLogP | 0.81 |
| TPSA | 166.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|