C21H25NO15S — CID 121366701
methyl (3S,5S,6S)-3,4,5-triacetyloxy-6-[4-(methylsulfonyloxymethyl)-2-nitrophenoxy]oxane-2-carboxylate (PubChem CID 121366701) has the molecular formula C21H25NO15S and a molecular weight of 563.49 g/mol. Its IUPAC name is methyl (3S,5S,6S)-3,4,5-triacetyloxy-6-[4-(methylsulfonyloxymethyl)-2-nitrophenoxy]oxane-2-carboxylate.
| Compound Name | methyl (3S,5S,6S)-3,4,5-triacetyloxy-6-[4-(methylsulfonyloxymethyl)-2-nitrophenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 121366701 |
| Molecular Formula | C21H25NO15S |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | methyl (3S,5S,6S)-3,4,5-triacetyloxy-6-[4-(methylsulfonyloxymethyl)-2-nitrophenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)C1O[C@@H](Oc2ccc(COS(C)(=O)=O)cc2[N+](=O)[O-])[C@@H](OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H25NO15S/c1-10(23)33-16-17(34-11(2)24)19(35-12(3)25)21(37-18(16)20(26)31-4)36-15-7-6-13(8-14(15)22(27)28)9-32-38(5,29)30/h6-8,16-19,21H,9H2,1-5H3/t16-,17?,18?,19-,21+/m0/s1 |
| InChIKey | IFEDMMQEUOEFFO-FTISGTJISA-N |
| XLogP | 0.14 |
| TPSA | 210.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|