C20H23NO13 — CID 175803579
2-[3,5-bis(carboxymethyl)-2-[4-(hydroxymethyl)-2-nitrophenoxy]-6-methoxycarbonyloxan-4-yl]acetic acid (PubChem CID 175803579) has the molecular formula C20H23NO13 and a molecular weight of 485.40 g/mol. Its IUPAC name is 2-[3,5-bis(carboxymethyl)-2-[4-(hydroxymethyl)-2-nitrophenoxy]-6-methoxycarbonyloxan-4-yl]acetic acid.
| Compound Name | 2-[3,5-bis(carboxymethyl)-2-[4-(hydroxymethyl)-2-nitrophenoxy]-6-methoxycarbonyloxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 175803579 |
| Molecular Formula | C20H23NO13 |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-[3,5-bis(carboxymethyl)-2-[4-(hydroxymethyl)-2-nitrophenoxy]-6-methoxycarbonyloxan-4-yl]acetic acid |
| SMILES | COC(=O)C1OC(Oc2ccc(CO)cc2[N+](=O)[O-])C(CC(=O)O)C(CC(=O)O)C1CC(=O)O |
| InChI | InChI=1S/C20H23NO13/c1-32-19(29)18-11(6-16(25)26)10(5-15(23)24)12(7-17(27)28)20(34-18)33-14-3-2-9(8-22)4-13(14)21(30)31/h2-4,10-12,18,20,22H,5-8H2,1H3,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | UNTRHGNFKBKTSO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 220.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|