C41H41NO9 — CID 71027417
[3-nitro-4-[(2S,3S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl]methanol (PubChem CID 71027417) has the molecular formula C41H41NO9 and a molecular weight of 691.78 g/mol. Its IUPAC name is [3-nitro-4-[(2S,3S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl]methanol.
| Compound Name | [3-nitro-4-[(2S,3S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl]methanol |
|---|---|
| PubChem CID | 71027417 |
| Molecular Formula | C41H41NO9 |
| Molecular Weight | 691.78 g/mol |
| Exact Mass | 691.28 |
| IUPAC Name | [3-nitro-4-[(2S,3S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl]methanol |
| SMILES | O=[N+]([O-])c1cc(CO)ccc1O[C@@H]1OC(COCc2ccccc2)[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H41NO9/c43-24-34-21-22-36(35(23-34)42(44)45)50-41-40(49-28-33-19-11-4-12-20-33)39(48-27-32-17-9-3-10-18-32)38(47-26-31-15-7-2-8-16-31)37(51-41)29-46-25-30-13-5-1-6-14-30/h1-23,37-41,43H,24-29H2/t37?,38-,39?,40-,41+/m0/s1 |
| InChIKey | QSWFYFXUUQFLGN-LRNLSEJRSA-N |
| XLogP | 7.16 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.78 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|