C41H41NO7 — CID 71623393
(2R,3S,4R,5R,6R)-2-[(4-nitrophenyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 71623393) has the molecular formula C41H41NO7 and a molecular weight of 659.78 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-[(4-nitrophenyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3S,4R,5R,6R)-2-[(4-nitrophenyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 71623393 |
| Molecular Formula | C41H41NO7 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-[(4-nitrophenyl)methyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | O=[N+]([O-])c1ccc(C[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C41H41NO7/c43-42(44)36-23-21-31(22-24-36)25-37-39(46-27-33-15-7-2-8-16-33)41(48-29-35-19-11-4-12-20-35)40(47-28-34-17-9-3-10-18-34)38(49-37)30-45-26-32-13-5-1-6-14-32/h1-24,37-41H,25-30H2/t37-,38-,39+,40-,41-/m1/s1 |
| InChIKey | CNUHKGAKUPRARH-PGSFLWIGSA-N |
| XLogP | 7.88 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|