C41H36N2O12 — CID 22806753
[(2S,3R,4S,5S,6R)-2-(4-nitrobenzoyl)oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 4-nitrobenzoate (PubChem CID 22806753) has the molecular formula C41H36N2O12 and a molecular weight of 748.74 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-2-(4-nitrobenzoyl)oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2S,3R,4S,5S,6R)-2-(4-nitrobenzoyl)oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 22806753 |
| Molecular Formula | C41H36N2O12 |
| Molecular Weight | 748.74 g/mol |
| Exact Mass | 748.23 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-2-(4-nitrobenzoyl)oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C41H36N2O12/c44-39(31-16-20-33(21-17-31)42(46)47)54-38-37(52-26-30-14-8-3-9-15-30)36(51-25-29-12-6-2-7-13-29)35(27-50-24-28-10-4-1-5-11-28)53-41(38)55-40(45)32-18-22-34(23-19-32)43(48)49/h1-23,35-38,41H,24-27H2/t35-,36+,37+,38-,41+/m1/s1 |
| InChIKey | VRWXCCCBATWGGB-YPOPMRGPSA-N |
| XLogP | 7.00 |
| TPSA | 175.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.74 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|