C20H21NO6 — CID 143964092
[3-methyl-5-(phenylmethoxymethyl)oxolan-2-yl] 4-nitrobenzoate (PubChem CID 143964092) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is [3-methyl-5-(phenylmethoxymethyl)oxolan-2-yl] 4-nitrobenzoate.
| Compound Name | [3-methyl-5-(phenylmethoxymethyl)oxolan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 143964092 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [3-methyl-5-(phenylmethoxymethyl)oxolan-2-yl] 4-nitrobenzoate |
| SMILES | CC1CC(COCc2ccccc2)OC1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21NO6/c1-14-11-18(13-25-12-15-5-3-2-4-6-15)26-20(14)27-19(22)16-7-9-17(10-8-16)21(23)24/h2-10,14,18,20H,11-13H2,1H3 |
| InChIKey | PPBKZEFQWLWAGH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|