C31H37N3O12S — CID 72547269
[(2S,3R,4R,5S,6R)-3-acetamido-2-(4-nitrophenoxy)-6-(phenylmethoxymethyl)-5-sulfooxyoxan-4-yl] benzoate;N,N-dimethylmethanamine (PubChem CID 72547269) has the molecular formula C31H37N3O12S and a molecular weight of 675.71 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-3-acetamido-2-(4-nitrophenoxy)-6-(phenylmethoxymethyl)-5-sulfooxyoxan-4-yl] benzoate;N,N-dimethylmethanamine.
| Compound Name | [(2S,3R,4R,5S,6R)-3-acetamido-2-(4-nitrophenoxy)-6-(phenylmethoxymethyl)-5-sulfooxyoxan-4-yl] benzoate;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 72547269 |
| Molecular Formula | C31H37N3O12S |
| Molecular Weight | 675.71 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-3-acetamido-2-(4-nitrophenoxy)-6-(phenylmethoxymethyl)-5-sulfooxyoxan-4-yl] benzoate;N,N-dimethylmethanamine |
| SMILES | CC(=O)N[C@H]1[C@H](Oc2ccc([N+](=O)[O-])cc2)O[C@H](COCc2ccccc2)[C@@H](OS(=O)(=O)O)[C@@H]1OC(=O)c1ccccc1.CN(C)C |
| InChI | InChI=1S/C28H28N2O12S.C3H9N/c1-18(31)29-24-26(41-27(32)20-10-6-3-7-11-20)25(42-43(35,36)37)23(17-38-16-19-8-4-2-5-9-19)40-28(24)39-22-14-12-21(13-15-22)30(33)34;1-4(2)3/h2-15,23-26,28H,16-17H2,1H3,(H,29,31)(H,35,36,37);1-3H3/t23-,24-,25-,26-,28-;/m1./s1 |
| InChIKey | PNGRGEHEONVQHP-DFYNJKIPSA-N |
| XLogP | 3.01 |
| TPSA | 193.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|